C12H20O — CID 176775112
2,4-bis(2-methylpropyl)furan (PubChem CID 176775112) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,4-bis(2-methylpropyl)furan.
| Compound Name | 2,4-bis(2-methylpropyl)furan |
|---|---|
| PubChem CID | 176775112 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2,4-bis(2-methylpropyl)furan |
| SMILES | CC(C)Cc1coc(CC(C)C)c1 |
| InChI | InChI=1S/C12H20O/c1-9(2)5-11-7-12(13-8-11)6-10(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | DQFFVSBNICDHLI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |