C20H23O4- — CID 140784123
3-(adamantane-1-carbonyloxy)-3-phenylpropanoate (PubChem CID 140784123) has the molecular formula C20H23O4- and a molecular weight of 327.40 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-3-phenylpropanoate.
| Compound Name | 3-(adamantane-1-carbonyloxy)-3-phenylpropanoate |
|---|---|
| PubChem CID | 140784123 |
| Molecular Formula | C20H23O4- |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-3-phenylpropanoate |
| SMILES | O=C([O-])CC(OC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C20H24O4/c21-18(22)9-17(16-4-2-1-3-5-16)24-19(23)20-10-13-6-14(11-20)8-15(7-13)12-20/h1-5,13-15,17H,6-12H2,(H,21,22)/p-1 |
| InChIKey | CWDDVIXRLUTGFX-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |