C17H25O4- — CID 140752897
3-(adamantane-1-carbonyloxy)-4-methylpentanoate (PubChem CID 140752897) has the molecular formula C17H25O4- and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-4-methylpentanoate.
| Compound Name | 3-(adamantane-1-carbonyloxy)-4-methylpentanoate |
|---|---|
| PubChem CID | 140752897 |
| Molecular Formula | C17H25O4- |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-4-methylpentanoate |
| SMILES | CC(C)C(CC(=O)[O-])OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H26O4/c1-10(2)14(6-15(18)19)21-16(20)17-7-11-3-12(8-17)5-13(4-11)9-17/h10-14H,3-9H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | NELQZFFYJLGYCK-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |