C18H27FN4O5 — CID 140784296
tert-butyl N-[(3R)-1-[4-carbamoyl-6-(dimethoxymethyl)-3-fluoro-2-pyridinyl]pyrrolidin-3-yl]carbamate (PubChem CID 140784296) has the molecular formula C18H27FN4O5 and a molecular weight of 398.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[4-carbamoyl-6-(dimethoxymethyl)-3-fluoro-2-pyridinyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[4-carbamoyl-6-(dimethoxymethyl)-3-fluoro-2-pyridinyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 140784296 |
| Molecular Formula | C18H27FN4O5 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | tert-butyl N-[(3R)-1-[4-carbamoyl-6-(dimethoxymethyl)-3-fluoro-2-pyridinyl]pyrrolidin-3-yl]carbamate |
| SMILES | COC(OC)c1cc(C(N)=O)c(F)c(N2CC[C@@H](NC(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C18H27FN4O5/c1-18(2,3)28-17(25)21-10-6-7-23(9-10)15-13(19)11(14(20)24)8-12(22-15)16(26-4)27-5/h8,10,16H,6-7,9H2,1-5H3,(H2,20,24)(H,21,25)/t10-/m1/s1 |
| InChIKey | MSFQCUOLRVVJNE-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|