C37H48F3NO2Si — CID 140785161
[(5S,6S)-5-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 140785161) has the molecular formula C37H48F3NO2Si and a molecular weight of 623.88 g/mol. Its IUPAC name is [(5S,6S)-5-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(5S,6S)-5-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140785161 |
| Molecular Formula | C37H48F3NO2Si |
| Molecular Weight | 623.88 g/mol |
| Exact Mass | 623.34 |
| IUPAC Name | [(5S,6S)-5-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](Oc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1c(F)cc(OCCN2CC(CF)C2)cc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H48F3NO2Si/c1-24(2)44(25(3)4,26(5)6)43-30-13-15-33-29(18-30)12-14-32(28-10-8-7-9-11-28)36(33)37-34(39)19-31(20-35(37)40)42-17-16-41-22-27(21-38)23-41/h7-11,13,15,18-20,24-27,32,36H,12,14,16-17,21-23H2,1-6H3/t32-,36+/m1/s1 |
| InChIKey | CAOJLHCZXLACMQ-KUFVUHJUSA-N |
| XLogP | 9.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.88 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|