C26H41O5- — CID 140785408
5,7-bis(methoxycarbonyl)-5,7-dimethyl-9-phenyltetradecan-3-olate (PubChem CID 140785408) has the molecular formula C26H41O5- and a molecular weight of 433.61 g/mol. Its IUPAC name is 5,7-bis(methoxycarbonyl)-5,7-dimethyl-9-phenyltetradecan-3-olate.
| Compound Name | 5,7-bis(methoxycarbonyl)-5,7-dimethyl-9-phenyltetradecan-3-olate |
|---|---|
| PubChem CID | 140785408 |
| Molecular Formula | C26H41O5- |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 5,7-bis(methoxycarbonyl)-5,7-dimethyl-9-phenyltetradecan-3-olate |
| SMILES | CCCCCC(CC(C)(CC(C)(CC([O-])CC)C(=O)OC)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C26H41O5/c1-7-9-11-16-21(20-14-12-10-13-15-20)17-25(3,23(28)30-5)19-26(4,24(29)31-6)18-22(27)8-2/h10,12-15,21-22H,7-9,11,16-19H2,1-6H3/q-1 |
| InChIKey | DEQVXASQZPMUHZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|