C39H52O4 — CID 158276501
5-O-butyl 1-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate (PubChem CID 158276501) has the molecular formula C39H52O4 and a molecular weight of 584.84 g/mol. Its IUPAC name is 5-O-butyl 1-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate.
| Compound Name | 5-O-butyl 1-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate |
|---|---|
| PubChem CID | 158276501 |
| Molecular Formula | C39H52O4 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | 5-O-butyl 1-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate |
| SMILES | CCCCOC(=O)C(C)CC(C)(CC(CC(CC(C)CC)c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C39H52O4/c1-7-9-25-43-36(40)31(4)27-38(5,37(41)42-6)29-39(34-21-15-11-16-22-34,35-23-17-12-18-24-35)28-33(26-30(3)8-2)32-19-13-10-14-20-32/h10-24,30-31,33H,7-9,25-29H2,1-6H3 |
| InChIKey | MEDDIAXRMFTFIM-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|