C41H57FO4 — CID 176587304
methyl 4-(4-fluorophenyl)-4-[4-(10-hydroxydecoxy)phenyl]-2,8-dimethyl-6-phenyldecanoate (PubChem CID 176587304) has the molecular formula C41H57FO4 and a molecular weight of 632.90 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-4-[4-(10-hydroxydecoxy)phenyl]-2,8-dimethyl-6-phenyldecanoate.
| Compound Name | methyl 4-(4-fluorophenyl)-4-[4-(10-hydroxydecoxy)phenyl]-2,8-dimethyl-6-phenyldecanoate |
|---|---|
| PubChem CID | 176587304 |
| Molecular Formula | C41H57FO4 |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 632.42 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-4-[4-(10-hydroxydecoxy)phenyl]-2,8-dimethyl-6-phenyldecanoate |
| SMILES | CCC(C)CC(CC(CC(C)C(=O)OC)(c1ccc(F)cc1)c1ccc(OCCCCCCCCCCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H57FO4/c1-5-32(2)29-35(34-17-13-12-14-18-34)31-41(30-33(3)40(44)45-4,36-19-23-38(42)24-20-36)37-21-25-39(26-22-37)46-28-16-11-9-7-6-8-10-15-27-43/h12-14,17-26,32-33,35,43H,5-11,15-16,27-31H2,1-4H3 |
| InChIKey | FJEGVMOPGPGEBY-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|