C40H58O3Si — CID 176587327
methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2,8-dimethyl-4,6-diphenyldecanoate (PubChem CID 176587327) has the molecular formula C40H58O3Si and a molecular weight of 614.99 g/mol. Its IUPAC name is methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2,8-dimethyl-4,6-diphenyldecanoate.
| Compound Name | methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2,8-dimethyl-4,6-diphenyldecanoate |
|---|---|
| PubChem CID | 176587327 |
| Molecular Formula | C40H58O3Si |
| Molecular Weight | 614.99 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-2,8-dimethyl-4,6-diphenyldecanoate |
| SMILES | CCC(C)CC(CC(CC(C)C(=O)OC)(c1ccccc1)c1ccc(CCCO[Si](C)(C)C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C40H58O3Si/c1-10-31(2)28-35(34-19-13-11-14-20-34)30-40(29-32(3)38(41)42-7,36-21-15-12-16-22-36)37-25-23-33(24-26-37)18-17-27-43-44(8,9)39(4,5)6/h11-16,19-26,31-32,35H,10,17-18,27-30H2,1-9H3 |
| InChIKey | LNJXKCIVIIUMEK-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.99 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|