C33H40 — CID 161058351
1-tert-butyl-4-(3-methyl-7,7-diphenyldec-9-yn-5-yl)benzene (PubChem CID 161058351) has the molecular formula C33H40 and a molecular weight of 436.68 g/mol. Its IUPAC name is 1-tert-butyl-4-(3-methyl-7,7-diphenyldec-9-yn-5-yl)benzene.
| Compound Name | 1-tert-butyl-4-(3-methyl-7,7-diphenyldec-9-yn-5-yl)benzene |
|---|---|
| PubChem CID | 161058351 |
| Molecular Formula | C33H40 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 1-tert-butyl-4-(3-methyl-7,7-diphenyldec-9-yn-5-yl)benzene |
| SMILES | C#CCC(CC(CC(C)CC)c1ccc(C(C)(C)C)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H40/c1-7-23-33(30-15-11-9-12-16-30,31-17-13-10-14-18-31)25-28(24-26(3)8-2)27-19-21-29(22-20-27)32(4,5)6/h1,9-22,26,28H,8,23-25H2,2-6H3 |
| InChIKey | UDBCCFODIWRTDF-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|