C39H39F17O2 — CID 122498783
3-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-7-methyl-3,5-diphenylnonan-1-ol (PubChem CID 122498783) has the molecular formula C39H39F17O2 and a molecular weight of 862.70 g/mol. Its IUPAC name is 3-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-7-methyl-3,5-diphenylnonan-1-ol.
| Compound Name | 3-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-7-methyl-3,5-diphenylnonan-1-ol |
|---|---|
| PubChem CID | 122498783 |
| Molecular Formula | C39H39F17O2 |
| Molecular Weight | 862.70 g/mol |
| Exact Mass | 862.27 |
| IUPAC Name | 3-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]-7-methyl-3,5-diphenylnonan-1-ol |
| SMILES | CCC(C)CC(CC(CCO)(c1ccccc1)c1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C39H39F17O2/c1-3-25(2)23-27(26-11-6-4-7-12-26)24-31(20-21-57,28-13-8-5-9-14-28)29-15-17-30(18-16-29)58-22-10-19-32(40,41)33(42,43)34(44,45)35(46,47)36(48,49)37(50,51)38(52,53)39(54,55)56/h4-9,11-18,25,27,57H,3,10,19-24H2,1-2H3 |
| InChIKey | QLBSKZKJBRAVCU-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.70 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|