C34H44O3 — CID 176587316
methyl 4-[4-(3-hydroxypropyl)phenyl]-2,8-dimethyl-4,6-diphenyldecanoate (PubChem CID 176587316) has the molecular formula C34H44O3 and a molecular weight of 500.72 g/mol. Its IUPAC name is methyl 4-[4-(3-hydroxypropyl)phenyl]-2,8-dimethyl-4,6-diphenyldecanoate.
| Compound Name | methyl 4-[4-(3-hydroxypropyl)phenyl]-2,8-dimethyl-4,6-diphenyldecanoate |
|---|---|
| PubChem CID | 176587316 |
| Molecular Formula | C34H44O3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | methyl 4-[4-(3-hydroxypropyl)phenyl]-2,8-dimethyl-4,6-diphenyldecanoate |
| SMILES | CCC(C)CC(CC(CC(C)C(=O)OC)(c1ccccc1)c1ccc(CCCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H44O3/c1-5-26(2)23-30(29-14-8-6-9-15-29)25-34(24-27(3)33(36)37-4,31-16-10-7-11-17-31)32-20-18-28(19-21-32)13-12-22-35/h6-11,14-21,26-27,30,35H,5,12-13,22-25H2,1-4H3 |
| InChIKey | WPZWEBSFOQUVDD-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |