C51H82O6Si2 — CID 176587333
methyl 4,4-bis[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]phenyl]-2,8-dimethyl-6-phenyldecanoate (PubChem CID 176587333) has the molecular formula C51H82O6Si2 and a molecular weight of 847.38 g/mol. Its IUPAC name is methyl 4,4-bis[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]phenyl]-2,8-dimethyl-6-phenyldecanoate.
| Compound Name | methyl 4,4-bis[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]phenyl]-2,8-dimethyl-6-phenyldecanoate |
|---|---|
| PubChem CID | 176587333 |
| Molecular Formula | C51H82O6Si2 |
| Molecular Weight | 847.38 g/mol |
| Exact Mass | 846.56 |
| IUPAC Name | methyl 4,4-bis[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]phenyl]-2,8-dimethyl-6-phenyldecanoate |
| SMILES | CCC(C)CC(CC(CC(C)C(=O)OC)(c1cccc(COCCCO[Si](C)(C)C(C)(C)C)c1)c1cccc(COCCCO[Si](C)(C)C(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C51H82O6Si2/c1-15-40(2)33-45(44-25-17-16-18-26-44)37-51(36-41(3)48(52)53-10,46-27-19-23-42(34-46)38-54-29-21-31-56-58(11,12)49(4,5)6)47-28-20-24-43(35-47)39-55-30-22-32-57-59(13,14)50(7,8)9/h16-20,23-28,34-35,40-41,45H,15,21-22,29-33,36-39H2,1-14H3 |
| InChIKey | DPMPCODNRJFCJQ-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.38 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|