C27H39O5P — CID 170659344
methyl 4-(4-diethoxyphosphorylphenyl)-2,6-dimethyl-4-phenyloctanoate (PubChem CID 170659344) has the molecular formula C27H39O5P and a molecular weight of 474.58 g/mol. Its IUPAC name is methyl 4-(4-diethoxyphosphorylphenyl)-2,6-dimethyl-4-phenyloctanoate.
| Compound Name | methyl 4-(4-diethoxyphosphorylphenyl)-2,6-dimethyl-4-phenyloctanoate |
|---|---|
| PubChem CID | 170659344 |
| Molecular Formula | C27H39O5P |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | methyl 4-(4-diethoxyphosphorylphenyl)-2,6-dimethyl-4-phenyloctanoate |
| SMILES | CCOP(=O)(OCC)c1ccc(C(CC(C)CC)(CC(C)C(=O)OC)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H39O5P/c1-7-21(4)19-27(20-22(5)26(28)30-6,23-13-11-10-12-14-23)24-15-17-25(18-16-24)33(29,31-8-2)32-9-3/h10-18,21-22H,7-9,19-20H2,1-6H3 |
| InChIKey | ZROYIAYIFFPCDQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|