C29H35BO3 — CID 159093841
(1-hydroxy-3,7-dimethyl-2-oxo-5,5-diphenylnonan-3-yl)-phenylborinic acid (PubChem CID 159093841) has the molecular formula C29H35BO3 and a molecular weight of 442.41 g/mol. Its IUPAC name is (1-hydroxy-3,7-dimethyl-2-oxo-5,5-diphenylnonan-3-yl)-phenylborinic acid.
| Compound Name | (1-hydroxy-3,7-dimethyl-2-oxo-5,5-diphenylnonan-3-yl)-phenylborinic acid |
|---|---|
| PubChem CID | 159093841 |
| Molecular Formula | C29H35BO3 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (1-hydroxy-3,7-dimethyl-2-oxo-5,5-diphenylnonan-3-yl)-phenylborinic acid |
| SMILES | CCC(C)CC(CC(C)(B(O)c1ccccc1)C(=O)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35BO3/c1-4-23(2)20-29(24-14-8-5-9-15-24,25-16-10-6-11-17-25)22-28(3,27(32)21-31)30(33)26-18-12-7-13-19-26/h5-19,23,31,33H,4,20-22H2,1-3H3 |
| InChIKey | KCKHIAAROGYSQX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|