C32H37NO2 — CID 168830173
benzyl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate (PubChem CID 168830173) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is benzyl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate.
| Compound Name | benzyl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate |
|---|---|
| PubChem CID | 168830173 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | benzyl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate |
| SMILES | CCC(C)CC(CC(C)(CCC#N)C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H37NO2/c1-4-26(2)23-32(28-17-10-6-11-18-28,29-19-12-7-13-20-29)25-31(3,21-14-22-33)30(34)35-24-27-15-8-5-9-16-27/h5-13,15-20,26H,4,14,21,23-25H2,1-3H3 |
| InChIKey | CINWITOCHOXAMW-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |