C34H41NO2 — CID 168830177
2-phenylpropan-2-yl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate (PubChem CID 168830177) has the molecular formula C34H41NO2 and a molecular weight of 495.71 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate.
| Compound Name | 2-phenylpropan-2-yl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate |
|---|---|
| PubChem CID | 168830177 |
| Molecular Formula | C34H41NO2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 2-phenylpropan-2-yl 2-(2-cyanoethyl)-2,6-dimethyl-4,4-diphenyloctanoate |
| SMILES | CCC(C)CC(CC(C)(CCC#N)C(=O)OC(C)(C)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H41NO2/c1-6-27(2)25-34(29-19-12-8-13-20-29,30-21-14-9-15-22-30)26-33(5,23-16-24-35)31(36)37-32(3,4)28-17-10-7-11-18-28/h7-15,17-22,27H,6,16,23,25-26H2,1-5H3 |
| InChIKey | INGNUICTZBOGMK-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |