C20H35NO2Si — CID 134905803
(3-methyl-1-phenyl-1-trimethylsilylpentyl) N,N-diethylcarbamate (PubChem CID 134905803) has the molecular formula C20H35NO2Si and a molecular weight of 349.59 g/mol. Its IUPAC name is (3-methyl-1-phenyl-1-trimethylsilylpentyl) N,N-diethylcarbamate.
| Compound Name | (3-methyl-1-phenyl-1-trimethylsilylpentyl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 134905803 |
| Molecular Formula | C20H35NO2Si |
| Molecular Weight | 349.59 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (3-methyl-1-phenyl-1-trimethylsilylpentyl) N,N-diethylcarbamate |
| SMILES | CCC(C)CC(OC(=O)N(CC)CC)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C20H35NO2Si/c1-8-17(4)16-20(24(5,6)7,18-14-12-11-13-15-18)23-19(22)21(9-2)10-3/h11-15,17H,8-10,16H2,1-7H3 |
| InChIKey | LJVITKNVRWTOIN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|