C37H34F17O- — CID 140734824
2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-(5-methyl-1,3-diphenylheptylidene)cyclohexa-1,3-diene (PubChem CID 140734824) has the molecular formula C37H34F17O- and a molecular weight of 817.64 g/mol. Its IUPAC name is 2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-(5-methyl-1,3-diphenylheptylidene)cyclohexa-1,3-diene.
| Compound Name | 2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-(5-methyl-1,3-diphenylheptylidene)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140734824 |
| Molecular Formula | C37H34F17O- |
| Molecular Weight | 817.64 g/mol |
| Exact Mass | 817.23 |
| IUPAC Name | 2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-5-(5-methyl-1,3-diphenylheptylidene)cyclohexa-1,3-diene |
| SMILES | CCC(C)CC(CC(=C1C=CC(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C[CH-]1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H34F17O/c1-3-23(2)21-27(24-11-6-4-7-12-24)22-29(25-13-8-5-9-14-25)26-15-17-28(18-16-26)55-20-10-19-30(38,39)31(40,41)32(42,43)33(44,45)34(46,47)35(48,49)36(50,51)37(52,53)54/h4-9,11-18,23,27H,3,10,19-22H2,1-2H3/q-1 |
| InChIKey | GLSLKEFAHYYOPA-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.64 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|