C63H59N4- — CID 166056719
4-[4,6,8-tris(4-cyanophenyl)-14-methyl-10,10,12-triphenylhexadecan-2-yl]benzonitrile (PubChem CID 166056719) has the molecular formula C63H59N4- and a molecular weight of 872.19 g/mol. Its IUPAC name is 4-[4,6,8-tris(4-cyanophenyl)-14-methyl-10,10,12-triphenylhexadecan-2-yl]benzonitrile.
| Compound Name | 4-[4,6,8-tris(4-cyanophenyl)-14-methyl-10,10,12-triphenylhexadecan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166056719 |
| Molecular Formula | C63H59N4- |
| Molecular Weight | 872.19 g/mol |
| Exact Mass | 871.47 |
| IUPAC Name | 4-[4,6,8-tris(4-cyanophenyl)-14-methyl-10,10,12-triphenylhexadecan-2-yl]benzonitrile |
| SMILES | [CH2-]C(CC(CC(CC(CC(CC(CC(C)CC)c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(C#N)cc1)c1ccc(C#N)cc1)c1ccc(C#N)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C63H59N4/c1-4-46(2)36-59(53-14-8-5-9-15-53)40-63(61-16-10-6-11-17-61,62-18-12-7-13-19-62)41-60(56-34-26-51(45-67)27-35-56)39-58(55-32-24-50(44-66)25-33-55)38-57(54-30-22-49(43-65)23-31-54)37-47(3)52-28-20-48(42-64)21-29-52/h5-35,46-47,57-60H,3-4,36-41H2,1-2H3/q-1 |
| InChIKey | WTIDFZJPFORUNS-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.19 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|