C43H26N4O2Zn — CID 140785452
zinc 2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaen-5-one (PubChem CID 140785452) has the molecular formula C43H26N4O2Zn and a molecular weight of 696.10 g/mol. Its IUPAC name is zinc 2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaen-5-one.
| Compound Name | zinc 2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaen-5-one |
|---|---|
| PubChem CID | 140785452 |
| Molecular Formula | C43H26N4O2Zn |
| Molecular Weight | 696.10 g/mol |
| Exact Mass | 694.13 |
| IUPAC Name | zinc 2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaen-5-one |
| SMILES | O=C1Oc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Zn+2] |
| InChI | InChI=1S/C43H27N4O2.Zn/c48-43-41-39(29-17-9-3-10-18-29)35-25-23-33(45-35)37(27-13-5-1-6-14-27)31-21-22-32(44-31)38(28-15-7-2-8-16-28)34-24-26-36(46-34)40(42(47-41)49-43)30-19-11-4-12-20-30;/h1-26H,(H-,44,45,46,47,48);/q-1;+2/p-1 |
| InChIKey | XOUGEYPZQPDRHC-UHFFFAOYSA-M |
| XLogP | 9.63 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.10 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|