C43H28N2 — CID 140792646
18-(7-isocyano-9,9-dimethylfluoren-2-yl)-21-phenyl-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene (PubChem CID 140792646) has the molecular formula C43H28N2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 18-(7-isocyano-9,9-dimethylfluoren-2-yl)-21-phenyl-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene.
| Compound Name | 18-(7-isocyano-9,9-dimethylfluoren-2-yl)-21-phenyl-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene |
|---|---|
| PubChem CID | 140792646 |
| Molecular Formula | C43H28N2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 18-(7-isocyano-9,9-dimethylfluoren-2-yl)-21-phenyl-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1cc(-c3ccc4c(c3)c(-c3ccccc3)nc3c5ccccc5c5ccccc5c43)ccc1-2 |
| InChI | InChI=1S/C43H28N2/c1-43(2)38-24-28(17-20-32(38)33-22-19-29(44-3)25-39(33)43)27-18-21-35-37(23-27)41(26-11-5-4-6-12-26)45-42-36-16-10-8-14-31(36)30-13-7-9-15-34(30)40(35)42/h4-25H,1-2H3 |
| InChIKey | JLJSPSOHUSPDRK-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|