C36H24N4 — CID 140782487
4-(7-isocyano-9,9-dimethylfluoren-2-yl)-9-phenyl-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene (PubChem CID 140782487) has the molecular formula C36H24N4 and a molecular weight of 512.62 g/mol. Its IUPAC name is 4-(7-isocyano-9,9-dimethylfluoren-2-yl)-9-phenyl-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene.
| Compound Name | 4-(7-isocyano-9,9-dimethylfluoren-2-yl)-9-phenyl-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene |
|---|---|
| PubChem CID | 140782487 |
| Molecular Formula | C36H24N4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 4-(7-isocyano-9,9-dimethylfluoren-2-yl)-9-phenyl-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,12,14,16-octaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1cc(-c3ccc4nc(-c5ccccc5)c5c(nc6ccccn65)c4c3)ccc1-2 |
| InChI | InChI=1S/C36H24N4/c1-36(2)29-20-24(12-15-26(29)27-16-14-25(37-3)21-30(27)36)23-13-17-31-28(19-23)34-35(40-18-8-7-11-32(40)39-34)33(38-31)22-9-5-4-6-10-22/h4-21H,1-2H3 |
| InChIKey | BEXCNLDXRHLHHZ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 34.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|