C36H25FN2O4S — CID 140793497
2-cyano-3-[2-fluoro-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 140793497) has the molecular formula C36H25FN2O4S and a molecular weight of 600.67 g/mol. Its IUPAC name is 2-cyano-3-[2-fluoro-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[2-fluoro-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 140793497 |
| Molecular Formula | C36H25FN2O4S |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 2-cyano-3-[2-fluoro-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(N(c2ccc(C#Cc3ccc(-c4ccc(C=C(C#N)C(=O)O)c(F)c4)s3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H25FN2O4S/c1-42-31-14-10-29(11-15-31)39(30-12-16-32(43-2)17-13-30)28-8-3-24(4-9-28)5-18-33-19-20-35(44-33)26-7-6-25(34(37)22-26)21-27(23-38)36(40)41/h3-4,6-17,19-22H,1-2H3,(H,40,41) |
| InChIKey | VZSIBJNCPLMBLQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|