C42H44N2O4S2 — CID 91449166
2-cyano-3-[5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 91449166) has the molecular formula C42H44N2O4S2 and a molecular weight of 704.96 g/mol. Its IUPAC name is 2-cyano-3-[5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91449166 |
| Molecular Formula | C42H44N2O4S2 |
| Molecular Weight | 704.96 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | 2-cyano-3-[5-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3ccc(-c4ccc(C=C(C#N)C(=O)O)s4)s3)cc2)cc1 |
| InChI | InChI=1S/C42H44N2O4S2/c1-3-5-7-9-27-47-36-19-15-34(16-20-36)44(35-17-21-37(22-18-35)48-28-10-8-6-4-2)33-13-11-31(12-14-33)39-25-26-41(50-39)40-24-23-38(49-40)29-32(30-43)42(45)46/h11-26,29H,3-10,27-28H2,1-2H3,(H,45,46) |
| InChIKey | JHBUJSCHVMJPPY-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.96 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|