About tribenzyl cyclohexyl silicate
tribenzyl cyclohexyl silicate (PubChem CID 140793661) has the molecular formula C27H32O4Si
and a molecular weight of 448.63 g/mol. Its IUPAC name is tribenzyl cyclohexyl silicate.
Molecular Properties
| Compound Name | tribenzyl cyclohexyl silicate |
| PubChem CID | 140793661 |
| Molecular Formula | C27H32O4Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | tribenzyl cyclohexyl silicate |
| SMILES | c1ccc(CO[Si](OCc2ccccc2)(OCc2ccccc2)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H32O4Si/c1-5-13-24(14-6-1)21-28-32(31-27-19-11-4-12-20-27,29-22-25-15-7-2-8-16-25)30-23-26-17-9-3-10-18-26/h1-3,5-10,13-18,27H,4,11-12,19-23H2 |
| InChIKey | QYDHDHIJYIGOAM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tribenzyl cyclohexyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribenzyl cyclohexyl silicate?
The IUPAC name of tribenzyl cyclohexyl silicate (CID 140793661) is tribenzyl cyclohexyl silicate.
What is the SMILES notation for tribenzyl cyclohexyl silicate?
The canonical SMILES for tribenzyl cyclohexyl silicate is c1ccc(CO[Si](OCc2ccccc2)(OCc2ccccc2)OC2CCCCC2)cc1.
What is the InChIKey of tribenzyl cyclohexyl silicate?
The InChIKey is QYDHDHIJYIGOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32O4Si/c1-5-13-24(14-6-1)21-28-32(31-27-19-11-4-12-20-27,29-22-25-15-7-2-8-16-25)30-23-26-17-9-3-10-18-26/h1-3,5-10,13-18,27H,4,11-12,19-23H2.
What are the key properties of tribenzyl cyclohexyl silicate?
tribenzyl cyclohexyl silicate has a molecular weight of 448.63 g/mol, XLogP of 6.42, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tribenzyl cyclohexyl silicate is sourced from PubChem (CID 140793661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).