About cyclohexylbenzene;ethenoxymethylbenzene
cyclohexylbenzene;ethenoxymethylbenzene (PubChem CID 161044898) has the molecular formula C21H26O
and a molecular weight of 294.44 g/mol. Its IUPAC name is cyclohexylbenzene;ethenoxymethylbenzene.
Molecular Properties
| Compound Name | cyclohexylbenzene;ethenoxymethylbenzene |
| PubChem CID | 161044898 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | cyclohexylbenzene;ethenoxymethylbenzene |
| SMILES | C=COCc1ccccc1.c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.C9H10O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-10-8-9-6-4-3-5-7-9/h1,3-4,7-8,12H,2,5-6,9-10H2;2-7H,1,8H2 |
| InChIKey | UBJIYTDIOQUSNR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylbenzene;ethenoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylbenzene;ethenoxymethylbenzene?
The IUPAC name of cyclohexylbenzene;ethenoxymethylbenzene (CID 161044898) is cyclohexylbenzene;ethenoxymethylbenzene.
What is the SMILES notation for cyclohexylbenzene;ethenoxymethylbenzene?
The canonical SMILES for cyclohexylbenzene;ethenoxymethylbenzene is C=COCc1ccccc1.c1ccc(C2CCCCC2)cc1.
What is the InChIKey of cyclohexylbenzene;ethenoxymethylbenzene?
The InChIKey is UBJIYTDIOQUSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C9H10O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-10-8-9-6-4-3-5-7-9/h1,3-4,7-8,12H,2,5-6,9-10H2;2-7H,1,8H2.
What are the key properties of cyclohexylbenzene;ethenoxymethylbenzene?
cyclohexylbenzene;ethenoxymethylbenzene has a molecular weight of 294.44 g/mol, XLogP of 6.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylbenzene;ethenoxymethylbenzene is sourced from PubChem (CID 161044898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).