C16H20O — CID 102201544
3-cyclohexylpropa-1,2-dienoxymethylbenzene (PubChem CID 102201544) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-cyclohexylpropa-1,2-dienoxymethylbenzene.
| Compound Name | 3-cyclohexylpropa-1,2-dienoxymethylbenzene |
|---|---|
| PubChem CID | 102201544 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-cyclohexylpropa-1,2-dienoxymethylbenzene |
| SMILES | C(=COCc1ccccc1)=CC1CCCCC1 |
| InChI | InChI=1S/C16H20O/c1-3-8-15(9-4-1)12-7-13-17-14-16-10-5-2-6-11-16/h2,5-6,10-13,15H,1,3-4,8-9,14H2 |
| InChIKey | OHGWZUNOFHFBLT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|