C59H32N6 — CID 140794206
2-carbazol-9-yl-5-[3-cyano-4-(11,11-diphenylindeno[1,2-b]carbazol-5-yl)phenyl]-3-isocyanobenzene-1,4-dicarbonitrile (PubChem CID 140794206) has the molecular formula C59H32N6 and a molecular weight of 824.95 g/mol. Its IUPAC name is 2-carbazol-9-yl-5-[3-cyano-4-(11,11-diphenylindeno[1,2-b]carbazol-5-yl)phenyl]-3-isocyanobenzene-1,4-dicarbonitrile.
| Compound Name | 2-carbazol-9-yl-5-[3-cyano-4-(11,11-diphenylindeno[1,2-b]carbazol-5-yl)phenyl]-3-isocyanobenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 140794206 |
| Molecular Formula | C59H32N6 |
| Molecular Weight | 824.95 g/mol |
| Exact Mass | 824.27 |
| IUPAC Name | 2-carbazol-9-yl-5-[3-cyano-4-(11,11-diphenylindeno[1,2-b]carbazol-5-yl)phenyl]-3-isocyanobenzene-1,4-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-c2ccc(-n3c4ccccc4c4cc5c(cc43)-c3ccccc3C5(c3ccccc3)c3ccccc3)c(C#N)c2)cc(C#N)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C59H32N6/c1-63-57-49(36-62)46(31-39(35-61)58(57)65-54-26-14-9-21-43(54)44-22-10-15-27-55(44)65)37-28-29-52(38(30-37)34-60)64-53-25-13-11-23-45(53)48-32-51-47(33-56(48)64)42-20-8-12-24-50(42)59(51,40-16-4-2-5-17-40)41-18-6-3-7-19-41/h2-33H |
| InChIKey | VAAMTMJWWWKFPA-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.95 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|