C5H12NO+ — CID 140794828
(2S,3R)-2,3-dimethylazetidin-1-ium-3-ol (PubChem CID 140794828) has the molecular formula C5H12NO+ and a molecular weight of 102.16 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol.
| Compound Name | (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol |
|---|---|
| PubChem CID | 140794828 |
| Molecular Formula | C5H12NO+ |
| Molecular Weight | 102.16 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol |
| SMILES | C[C@@H]1[NH2+]C[C@@]1(C)O |
| InChI | InChI=1S/C5H11NO/c1-4-5(2,7)3-6-4/h4,6-7H,3H2,1-2H3/p+1/t4-,5+/m0/s1 |
| InChIKey | XFSHKQNHVLCBRA-CRCLSJGQSA-O |
| XLogP | -1.30 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.16 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |