About (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol
(2S,3R)-2,3-dimethylazetidin-1-ium-3-ol (PubChem CID 140794828) has the molecular formula C5H12NO+
and a molecular weight of 102.16 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol.
Molecular Properties
| Compound Name | (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol |
| PubChem CID | 140794828 |
| Molecular Formula | C5H12NO+ |
| Molecular Weight | 102.16 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol |
| SMILES | C[C@@H]1[NH2+]C[C@@]1(C)O |
| InChI | InChI=1S/C5H11NO/c1-4-5(2,7)3-6-4/h4,6-7H,3H2,1-2H3/p+1/t4-,5+/m0/s1 |
| InChIKey | XFSHKQNHVLCBRA-CRCLSJGQSA-O |
| XLogP | -1.30 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.16 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol?
The IUPAC name of (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol (CID 140794828) is (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol.
What is the SMILES notation for (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol?
The canonical SMILES for (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol is C[C@@H]1[NH2+]C[C@@]1(C)O.
What is the InChIKey of (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol?
The InChIKey is XFSHKQNHVLCBRA-CRCLSJGQSA-O. The full InChI is InChI=1S/C5H11NO/c1-4-5(2,7)3-6-4/h4,6-7H,3H2,1-2H3/p+1/t4-,5+/m0/s1.
What are the key properties of (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol?
(2S,3R)-2,3-dimethylazetidin-1-ium-3-ol has a molecular weight of 102.16 g/mol, XLogP of -1.30, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2,3-dimethylazetidin-1-ium-3-ol is sourced from PubChem (CID 140794828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).