C34H21N5O — CID 140798554
12-[6-(3-isocyanophenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole (PubChem CID 140798554) has the molecular formula C34H21N5O and a molecular weight of 515.58 g/mol. Its IUPAC name is 12-[6-(3-isocyanophenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 12-[6-(3-isocyanophenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 140798554 |
| Molecular Formula | C34H21N5O |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 12-[6-(3-isocyanophenyl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole |
| SMILES | [C-]#[N+]c1cccc(C2=NC(c3ccccc3)N=C(n3c4ccccc4c4ccc5c6ccccc6oc5c43)N2)c1 |
| InChI | InChI=1S/C34H21N5O/c1-35-23-13-9-12-22(20-23)33-36-32(21-10-3-2-4-11-21)37-34(38-33)39-28-16-7-5-14-24(28)26-18-19-27-25-15-6-8-17-29(25)40-31(27)30(26)39/h2-20,32H,(H,36,37,38) |
| InChIKey | DTFVDOLRGZMUFN-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 59.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|