C16H26O5Si2 — CID 140798982
4-[[(4-methoxycarbonylphenyl)-dimethylsilyl]oxy-dimethylsilyl]butanoic acid (PubChem CID 140798982) has the molecular formula C16H26O5Si2 and a molecular weight of 354.55 g/mol. Its IUPAC name is 4-[[(4-methoxycarbonylphenyl)-dimethylsilyl]oxy-dimethylsilyl]butanoic acid.
| Compound Name | 4-[[(4-methoxycarbonylphenyl)-dimethylsilyl]oxy-dimethylsilyl]butanoic acid |
|---|---|
| PubChem CID | 140798982 |
| Molecular Formula | C16H26O5Si2 |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4-[[(4-methoxycarbonylphenyl)-dimethylsilyl]oxy-dimethylsilyl]butanoic acid |
| SMILES | COC(=O)c1ccc([Si](C)(C)O[Si](C)(C)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C16H26O5Si2/c1-20-16(19)13-8-10-14(11-9-13)23(4,5)21-22(2,3)12-6-7-15(17)18/h8-11H,6-7,12H2,1-5H3,(H,17,18) |
| InChIKey | WOOGOQRNWVJYJE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|