C24H44FNO5 — CID 140802147
(2R,3S,4R,5S)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 140802147) has the molecular formula C24H44FNO5 and a molecular weight of 445.62 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 140802147 |
| Molecular Formula | C24H44FNO5 |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (2R,3S,4R,5S)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)[C@@H](O)CN1CCCCCOCC1CCC(C2CCCCC2)C(F)C1 |
| InChI | InChI=1S/C24H44FNO5/c25-20-13-17(9-10-19(20)18-7-3-1-4-8-18)16-31-12-6-2-5-11-26-14-22(28)24(30)23(29)21(26)15-27/h17-24,27-30H,1-16H2/t17?,19?,20?,21-,22+,23+,24-/m1/s1 |
| InChIKey | JVNFDIDOZZLLQK-FCCLPNMQSA-N |
| XLogP | 2.27 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|