C22H39NO5 — CID 123515284
2-(hydroxymethyl)-1-[5-[(4-methyl-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]pentyl]piperidine-3,4,5-triol (PubChem CID 123515284) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-[5-[(4-methyl-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]pentyl]piperidine-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-1-[5-[(4-methyl-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]pentyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 123515284 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 2-(hydroxymethyl)-1-[5-[(4-methyl-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]pentyl]piperidine-3,4,5-triol |
| SMILES | CC1C2CC3CC(COCCCCCN4CC(O)C(O)C(O)C4CO)(C2)CC31 |
| InChI | InChI=1S/C22H39NO5/c1-14-15-7-16-9-22(8-15,10-17(14)16)13-28-6-4-2-3-5-23-11-19(25)21(27)20(26)18(23)12-24/h14-21,24-27H,2-13H2,1H3 |
| InChIKey | CEQZTEHLPNOODS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|