C7H8ClN3O — CID 140802487
2-chloro-N-(oxetan-3-yl)pyrimidin-4-amine (PubChem CID 140802487) has the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. Its IUPAC name is 2-chloro-N-(oxetan-3-yl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(oxetan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 140802487 |
| Molecular Formula | C7H8ClN3O |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 2-chloro-N-(oxetan-3-yl)pyrimidin-4-amine |
| SMILES | Clc1nccc(NC2COC2)n1 |
| InChI | InChI=1S/C7H8ClN3O/c8-7-9-2-1-6(11-7)10-5-3-12-4-5/h1-2,5H,3-4H2,(H,9,10,11) |
| InChIKey | QKLVFIVPDJXETQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |