C11H14ClN3 — CID 130701603
N-(7-bicyclo[4.1.0]heptanyl)-2-chloropyrimidin-4-amine (PubChem CID 130701603) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is N-(7-bicyclo[4.1.0]heptanyl)-2-chloropyrimidin-4-amine.
| Compound Name | N-(7-bicyclo[4.1.0]heptanyl)-2-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 130701603 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-(7-bicyclo[4.1.0]heptanyl)-2-chloropyrimidin-4-amine |
| SMILES | Clc1nccc(NC2C3CCCCC32)n1 |
| InChI | InChI=1S/C11H14ClN3/c12-11-13-6-5-9(15-11)14-10-7-3-1-2-4-8(7)10/h5-8,10H,1-4H2,(H,13,14,15) |
| InChIKey | DCKOMDUWEOGPKT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |