C18H21ClN3O4S2+ — CID 140807182
[3-chloro-2-[3-(2-piperidin-1-ium-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] methanesulfonate (PubChem CID 140807182) has the molecular formula C18H21ClN3O4S2+ and a molecular weight of 442.97 g/mol. Its IUPAC name is [3-chloro-2-[3-(2-piperidin-1-ium-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] methanesulfonate.
| Compound Name | [3-chloro-2-[3-(2-piperidin-1-ium-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 140807182 |
| Molecular Formula | C18H21ClN3O4S2+ |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [3-chloro-2-[3-(2-piperidin-1-ium-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(Cl)c1C1CC(c2csc(C3CC[NH2+]CC3)n2)=NO1 |
| InChI | InChI=1S/C18H20ClN3O4S2/c1-28(23,24)26-15-4-2-3-12(19)17(15)16-9-13(22-25-16)14-10-27-18(21-14)11-5-7-20-8-6-11/h2-4,10-11,16,20H,5-9H2,1H3/p+1 |
| InChIKey | CBCJWCJFRGGSIP-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|