C18H22Cl2N3O2S2+ — CID 156791002
chloromethane;5-(2-chloro-6-methylsulfanyloxyphenyl)-3-(2-pyrrolidin-1-ium-3-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 156791002) has the molecular formula C18H22Cl2N3O2S2+ and a molecular weight of 447.43 g/mol. Its IUPAC name is chloromethane;5-(2-chloro-6-methylsulfanyloxyphenyl)-3-(2-pyrrolidin-1-ium-3-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazole.
| Compound Name | chloromethane;5-(2-chloro-6-methylsulfanyloxyphenyl)-3-(2-pyrrolidin-1-ium-3-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 156791002 |
| Molecular Formula | C18H22Cl2N3O2S2+ |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | chloromethane;5-(2-chloro-6-methylsulfanyloxyphenyl)-3-(2-pyrrolidin-1-ium-3-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | CCl.CSOc1cccc(Cl)c1C1CC(c2csc(C3CC[NH2+]C3)n2)=NO1 |
| InChI | InChI=1S/C17H18ClN3O2S2.CH3Cl/c1-24-23-14-4-2-3-11(18)16(14)15-7-12(21-22-15)13-9-25-17(20-13)10-5-6-19-8-10;1-2/h2-4,9-10,15,19H,5-8H2,1H3;1H3/p+1 |
| InChIKey | NUZAZEDPYNNVOT-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 60.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|