About tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate
tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate (PubChem CID 140808698) has the molecular formula C21H28FN3O5
and a molecular weight of 421.47 g/mol. Its IUPAC name is tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate |
| PubChem CID | 140808698 |
| Molecular Formula | C21H28FN3O5 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate |
| SMILES | CC(C)n1c(=O)n(CC2CCOC2)c(=O)c2cc(NC(=O)OC(C)(C)C)c(F)cc21 |
| InChI | InChI=1S/C21H28FN3O5/c1-12(2)25-17-9-15(22)16(23-19(27)30-21(3,4)5)8-14(17)18(26)24(20(25)28)10-13-6-7-29-11-13/h8-9,12-13H,6-7,10-11H2,1-5H3,(H,23,27) |
| InChIKey | SOIQJECSLIIKST-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate?
The IUPAC name of tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate (CID 140808698) is tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate.
What is the SMILES notation for tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate?
The canonical SMILES for tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate is CC(C)n1c(=O)n(CC2CCOC2)c(=O)c2cc(NC(=O)OC(C)(C)C)c(F)cc21.
What is the InChIKey of tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate?
The InChIKey is SOIQJECSLIIKST-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28FN3O5/c1-12(2)25-17-9-15(22)16(23-19(27)30-21(3,4)5)8-14(17)18(26)24(20(25)28)10-13-6-7-29-11-13/h8-9,12-13H,6-7,10-11H2,1-5H3,(H,23,27).
What are the key properties of tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate?
tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate has a molecular weight of 421.47 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[7-fluoro-2,4-dioxo-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazolin-6-yl]carbamate is sourced from PubChem (CID 140808698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).