C16H20FN3O3 — CID 130220639
6-amino-7-fluoro-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazoline-2,4-dione (PubChem CID 130220639) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 6-amino-7-fluoro-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazoline-2,4-dione.
| Compound Name | 6-amino-7-fluoro-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 130220639 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 6-amino-7-fluoro-3-(oxolan-3-ylmethyl)-1-propan-2-ylquinazoline-2,4-dione |
| SMILES | CC(C)n1c(=O)n(CC2CCOC2)c(=O)c2cc(N)c(F)cc21 |
| InChI | InChI=1S/C16H20FN3O3/c1-9(2)20-14-6-12(17)13(18)5-11(14)15(21)19(16(20)22)7-10-3-4-23-8-10/h5-6,9-10H,3-4,7-8,18H2,1-2H3 |
| InChIKey | CIXTYDQXEDOKJX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|