C25H34BN3O5 — CID 140809127
methyl N-[(2S)-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]propan-2-yl]carbamate (PubChem CID 140809127) has the molecular formula C25H34BN3O5 and a molecular weight of 467.38 g/mol. Its IUPAC name is methyl N-[(2S)-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]propan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809127 |
| Molecular Formula | C25H34BN3O5 |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | methyl N-[(2S)-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]propan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C25H34BN3O5/c1-16(28-23(31)32-6)22(30)29-13-7-8-21(29)20-14-18(15-27-20)17-9-11-19(12-10-17)26-33-24(2,3)25(4,5)34-26/h9-12,15-16,21H,7-8,13-14H2,1-6H3,(H,28,31)/t16-,21-/m0/s1 |
| InChIKey | PRWKXIRPVMMGPD-KKSFZXQISA-N |
| XLogP | 2.91 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|