C28H40BN3O5 — CID 140809186
methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 140809186) has the molecular formula C28H40BN3O5 and a molecular weight of 509.46 g/mol. Its IUPAC name is methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809186 |
| Molecular Formula | C28H40BN3O5 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C(C)(C)C |
| InChI | InChI=1S/C28H40BN3O5/c1-26(2,3)23(31-25(34)35-8)24(33)32-15-9-10-22(32)21-16-19(17-30-21)18-11-13-20(14-12-18)29-36-27(4,5)28(6,7)37-29/h11-14,17,22-23H,9-10,15-16H2,1-8H3,(H,31,34)/t22-,23+/m0/s1 |
| InChIKey | CIHVVGLBWCMYJD-XZOQPEGZSA-N |
| XLogP | 3.93 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|