C19H18Cl2N6O3S — CID 140810584
1-(2-aminopyrimidin-5-yl)-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea (PubChem CID 140810584) has the molecular formula C19H18Cl2N6O3S and a molecular weight of 481.37 g/mol. Its IUPAC name is 1-(2-aminopyrimidin-5-yl)-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea.
| Compound Name | 1-(2-aminopyrimidin-5-yl)-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 140810584 |
| Molecular Formula | C19H18Cl2N6O3S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-(2-aminopyrimidin-5-yl)-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)N(NS(=O)(=O)c1ccccc1)c1cnc(N)nc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H18Cl2N6O3S/c1-12(15-8-5-9-16(20)17(15)21)25-19(28)27(13-10-23-18(22)24-11-13)26-31(29,30)14-6-3-2-4-7-14/h2-12,26H,1H3,(H,25,28)(H2,22,23,24)/t12-/m0/s1 |
| InChIKey | IPLRYGSCVUAEDR-LBPRGKRZSA-N |
| XLogP | 3.54 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|