C25H28Cl2N4O3S — CID 140810520
1-[4-(2-amino-2-methylpropyl)phenyl]-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea (PubChem CID 140810520) has the molecular formula C25H28Cl2N4O3S and a molecular weight of 535.50 g/mol. Its IUPAC name is 1-[4-(2-amino-2-methylpropyl)phenyl]-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea.
| Compound Name | 1-[4-(2-amino-2-methylpropyl)phenyl]-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 140810520 |
| Molecular Formula | C25H28Cl2N4O3S |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-[4-(2-amino-2-methylpropyl)phenyl]-1-(benzenesulfonamido)-3-[(1S)-1-(2,3-dichlorophenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)N(NS(=O)(=O)c1ccccc1)c1ccc(CC(C)(C)N)cc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C25H28Cl2N4O3S/c1-17(21-10-7-11-22(26)23(21)27)29-24(32)31(30-35(33,34)20-8-5-4-6-9-20)19-14-12-18(13-15-19)16-25(2,3)28/h4-15,17,30H,16,28H2,1-3H3,(H,29,32)/t17-/m0/s1 |
| InChIKey | ZUENUYSUOOBMTL-KRWDZBQOSA-N |
| XLogP | 5.44 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|