C35H42F2N6O3SSi — CID 140811185
2-[1-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,6-difluorophenyl]methyl]indazol-3-yl]-5-[3-[(R)-methylsulfinyl]propyl]-N-pyridin-4-ylpyrimidin-4-amine (PubChem CID 140811185) has the molecular formula C35H42F2N6O3SSi and a molecular weight of 692.91 g/mol. Its IUPAC name is 2-[1-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,6-difluorophenyl]methyl]indazol-3-yl]-5-[3-[(R)-methylsulfinyl]propyl]-N-pyridin-4-ylpyrimidin-4-amine.
| Compound Name | 2-[1-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,6-difluorophenyl]methyl]indazol-3-yl]-5-[3-[(R)-methylsulfinyl]propyl]-N-pyridin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 140811185 |
| Molecular Formula | C35H42F2N6O3SSi |
| Molecular Weight | 692.91 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | 2-[1-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,6-difluorophenyl]methyl]indazol-3-yl]-5-[3-[(R)-methylsulfinyl]propyl]-N-pyridin-4-ylpyrimidin-4-amine |
| SMILES | C[S@@](=O)CCCc1cnc(-c2nn(Cc3c(F)cc(OCCO[Si](C)(C)C(C)(C)C)cc3F)c3ccccc23)nc1Nc1ccncc1 |
| InChI | InChI=1S/C35H42F2N6O3SSi/c1-35(2,3)48(5,6)46-18-17-45-26-20-29(36)28(30(37)21-26)23-43-31-12-8-7-11-27(31)32(42-43)34-39-22-24(10-9-19-47(4)44)33(41-34)40-25-13-15-38-16-14-25/h7-8,11-16,20-22H,9-10,17-19,23H2,1-6H3,(H,38,39,40,41)/t47-/m1/s1 |
| InChIKey | USRRRPGSHPBIHB-QZNUWAOFSA-N |
| XLogP | 7.67 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.91 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|