C37H44F2N6O4Si — CID 158191378
1-[4-[[5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-4-yl]amino]-2-pyridinyl]propan-2-one (PubChem CID 158191378) has the molecular formula C37H44F2N6O4Si and a molecular weight of 702.88 g/mol. Its IUPAC name is 1-[4-[[5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-4-yl]amino]-2-pyridinyl]propan-2-one.
| Compound Name | 1-[4-[[5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-4-yl]amino]-2-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 158191378 |
| Molecular Formula | C37H44F2N6O4Si |
| Molecular Weight | 702.88 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | 1-[4-[[5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidin-4-yl]amino]-2-pyridinyl]propan-2-one |
| SMILES | CCOc1cc(F)c(Cn2nc(-c3ncc(OCCCO[Si](C)(C)C(C)(C)C)c(Nc4ccnc(CC(C)=O)c4)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C37H44F2N6O4Si/c1-8-47-27-20-30(38)29(31(39)21-27)23-45-32-13-10-9-12-28(32)34(44-45)36-41-22-33(48-16-11-17-49-50(6,7)37(3,4)5)35(43-36)42-25-14-15-40-26(19-25)18-24(2)46/h9-10,12-15,19-22H,8,11,16-18,23H2,1-7H3,(H,40,41,42,43) |
| InChIKey | FZUIFUYMRBJOBC-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.88 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|