C23H35ClN2OPRu+2 — CID 140812818
[6-[(benzylamino)methyl]-2-pyridinyl]methyl-ditert-butylphosphanium;chloro(hydrido)ruthenium(2+);methanone (PubChem CID 140812818) has the molecular formula C23H35ClN2OPRu+2 and a molecular weight of 523.04 g/mol. Its IUPAC name is [6-[(benzylamino)methyl]-2-pyridinyl]methyl-ditert-butylphosphanium;chloro(hydrido)ruthenium(2+);methanone.
| Compound Name | [6-[(benzylamino)methyl]-2-pyridinyl]methyl-ditert-butylphosphanium;chloro(hydrido)ruthenium(2+);methanone |
|---|---|
| PubChem CID | 140812818 |
| Molecular Formula | C23H35ClN2OPRu+2 |
| Molecular Weight | 523.04 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | [6-[(benzylamino)methyl]-2-pyridinyl]methyl-ditert-butylphosphanium;chloro(hydrido)ruthenium(2+);methanone |
| SMILES | CC(C)(C)[PH+](Cc1cccc(CNCc2ccccc2)n1)C(C)(C)C.Cl[Ru+2].[CH-]=O |
| InChI | InChI=1S/C22H33N2P.CHO.ClH.Ru/c1-21(2,3)25(22(4,5)6)17-20-14-10-13-19(24-20)16-23-15-18-11-8-7-9-12-18;1-2;;/h7-14,23H,15-17H2,1-6H3;1H;1H;/q;-1;;+3 |
| InChIKey | ICGDIXXQAIZOLZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.04 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|