C27H36N4O5Si — CID 140817128
ethyl 5-[(Z)-3-hydroxy-3-phenylprop-2-enoyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate (PubChem CID 140817128) has the molecular formula C27H36N4O5Si and a molecular weight of 524.69 g/mol. Its IUPAC name is ethyl 5-[(Z)-3-hydroxy-3-phenylprop-2-enoyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate.
| Compound Name | ethyl 5-[(Z)-3-hydroxy-3-phenylprop-2-enoyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 140817128 |
| Molecular Formula | C27H36N4O5Si |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | ethyl 5-[(Z)-3-hydroxy-3-phenylprop-2-enoyl]-6,6-dimethyl-3-[(1-trimethylsilylcyclobutanecarbonyl)amino]-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate |
| SMILES | CCOC(=O)n1nc2c(c1NC(=O)C1([Si](C)(C)C)CCC1)CN(C(=O)/C=C(\O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C27H36N4O5Si/c1-7-36-25(35)31-23(28-24(34)27(14-11-15-27)37(4,5)6)19-17-30(26(2,3)22(19)29-31)21(33)16-20(32)18-12-9-8-10-13-18/h8-10,12-13,16,32H,7,11,14-15,17H2,1-6H3,(H,28,34)/b20-16- |
| InChIKey | GLMKMOLEOJWWAG-SILNSSARSA-N |
| XLogP | 5.27 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|