C16H30N8O4S — CID 14081823
N-[1-[(2-amino-2-oxoethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 14081823) has the molecular formula C16H30N8O4S and a molecular weight of 430.54 g/mol. Its IUPAC name is N-[1-[(2-amino-2-oxoethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[1-[(2-amino-2-oxoethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 14081823 |
| Molecular Formula | C16H30N8O4S |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[1-[(2-amino-2-oxoethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(N)CS |
| InChI | InChI=1S/C16H30N8O4S/c17-9(8-29)15(28)24-6-2-4-11(24)14(27)23-10(3-1-5-21-16(19)20)13(26)22-7-12(18)25/h9-11,29H,1-8,17H2,(H2,18,25)(H,22,26)(H,23,27)(H4,19,20,21) |
| InChIKey | DWIUQKGXYLTJCE-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 212.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|