C18H18N4 — CID 140819673
2-[(2,2-dimethylcyclopentyl)amino]quinoline-3,8-dicarbonitrile (PubChem CID 140819673) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopentyl)amino]quinoline-3,8-dicarbonitrile.
| Compound Name | 2-[(2,2-dimethylcyclopentyl)amino]quinoline-3,8-dicarbonitrile |
|---|---|
| PubChem CID | 140819673 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(2,2-dimethylcyclopentyl)amino]quinoline-3,8-dicarbonitrile |
| SMILES | CC1(C)CCCC1Nc1nc2c(C#N)cccc2cc1C#N |
| InChI | InChI=1S/C18H18N4/c1-18(2)8-4-7-15(18)21-17-14(11-20)9-12-5-3-6-13(10-19)16(12)22-17/h3,5-6,9,15H,4,7-8H2,1-2H3,(H,21,22) |
| InChIKey | NIPOQZNXBYWWOJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |